Molecule Details
| InChIKey | CDPROXZBMHOBTQ-SJORKVTESA-N |
|---|---|
| Compound Name | Inogatran |
| Canonical SMILES | N=C(N)NCCCNC(=O)[C@@H]1CCCCN1C(=O)[C@@H](CC1CCCCC1)NCC(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.58 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19880 |
|---|---|
| Drug Name | Inogatran |
| CAS Number | 155415-08-0 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Inogatran is a small molecule drug. Inogatran has a monoisotopic molecular weight of 438.3 Da. |
Categories: Amino Acids Amino Acids, Peptides, and Proteins Anticoagulants Antithrombins Enzyme Inhibitors Hematologic Agents Protease Inhibitors Serine Protease Inhibitors
Cross-references: BindingDB: 50289562 CHEMBL114715 PDB: IGN ZINC: ZINC000003794149
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P00734 | F2 | Prothrombin | modulator | targets |