Molecule Details
| InChIKey | CCRUCMHMQXUZAT-LBPRGKRZSA-N |
|---|---|
| Canonical SMILES | CC(=O)NCC[C@@H]1CCc2ccc3nc(C)oc3c21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 10.2 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21700 |
|---|---|
| Drug Name | Nedemelteon |
| CAS Number | 1000334-38-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Nedemelteon is a small molecule drug. The usage of the INN stem '-melteon' in the name indicates that Nedemelteon is a melatonin receptor agonist. Nedemelteon has a monoisotopic molecular weight of 258.14 Da. |
Cross-references: BindingDB: 103443 CHEMBL3648356 ZINC: ZINC000043178897