Molecule Details
| InChIKey | CBGUOGMQLZIXBE-XGQKBEPLSA-N |
|---|---|
| Compound Name | Clobetasol Propionate |
| Canonical SMILES | CCC(=O)O[C@]1(C(=O)CCl)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.6 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01013 |
|---|---|
| Drug Name | Clobetasol propionate |
| CAS Number | 25122-46-7 |
| Groups | approved investigational |
| ATC Codes | nan |
| Description | Clobetasol propionate is a prednisolone derivative with higher specificity for glucocorticoid receptors than mineralocorticoid receptors.[L11815] It has demonstrated superior activity compared to [fluocinonide][A190963] and was first described in the literature in 1974.[A190936] Clobetasol Propionat... |
Categories: Adrenal Cortex Hormones Anti-Inflammatory Agents Corticosteroids Cytochrome P-450 CYP3A Inducers Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Inducers Cytochrome P-450 CYP3A4 Inducers (strength unknown) Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Inducers Cytochrome P-450 CYP3A5 Inducers (strength unknown) Cytochrome P-450 Enzyme Inducers Cytochrome P-450 Substrates Fused-Ring Compounds Glucocorticoids Hormones Hormones, Hormone Substitutes, and Hormone Antagonists Hyperglycemia-Associated Agents Immunosuppressive Agents Pregnadienes Pregnadienetriols Pregnanes Steroids Steroids, Fluorinated Thyroxine-binding globulin inhibitors
Cross-references: BindingDB: 39347 ChEBI: 31414 CHEMBL1159650 ChemSpider: 30399 Drugs Product Database (DPD): 7558 D01272 PDB: XRD PharmGKB: PA164744375 PubChem:32798 PubChem:46505670 RxCUI: 21245 Therapeutic Targets Database: DAP001183 Wikipedia: Clobetasol_propionate ZINC: ZINC000003977767
Target Activities (3)
DrugBank Target Actions (8)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | binder | carriers |
| P08185 | SERPINA6 | Corticosteroid-binding globulin | binder | carriers |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inducer | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | inducer | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P04150 | NR3C1 | Glucocorticoid receptor | agonist | targets |
| P08235 | NR3C2 | Mineralocorticoid receptor | agonist | targets |
| P04083 | P04083 | Annexin A1 | inducer | targets |