Molecule Details
| InChIKey | BYPMJBXPNZMNQD-PZJWPPBQSA-N |
|---|---|
| Compound Name | Zicronapine |
| Canonical SMILES | CN1CCN([C@@H]2C[C@@H](c3ccccc3)c3ccc(Cl)cc32)CC1(C)C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.12 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12188 |
|---|---|
| Drug Name | Zicronapine |
| CAS Number | 170381-16-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Zicronapine has been used in trials studying the treatment of Schizophrenia. |
Cross-references: CHEMBL3039528 ChemSpider: 9640456 PubChem:11465618 PubChem:347828474 Wikipedia: Zicronapine