Molecule Details
| InChIKey | BVXLAHSJXXSWFF-KEKPKEOLSA-N |
|---|---|
| Canonical SMILES | Cc1ncccc1NC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](OP(=O)(O)O)(C(F)(F)F)CC[C@@]21Cc1ccccc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.23 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12198 |
|---|---|
| Drug Name | Fosdagrocorat |
| CAS Number | 1044535-58-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Fosdagrocorat has been used in trials studying the treatment and basic science of Rheumatoid Arthritis. |
Categories: Acids, Carbocyclic Amides Benzene Derivatives Benzoates Organophosphorus Compounds
Cross-references: BindingDB: 140010 CHEMBL3137316 ChemSpider: 32699790 PubChem:24872952 PubChem:347828483 Wikipedia: Fosdagrocorat