Molecule Details
| InChIKey | BVGDAZBTIVRTGO-UONOGXRCSA-N |
|---|---|
| Canonical SMILES | COc1cc(N2CCNC[C@@H]2C)ncc1-c1cnc(N)c(O[C@H](C)c2c(Cl)ccc(F)c2Cl)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.87 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21585 |
|---|---|
| Drug Name | Envonalkib |
| CAS Number | 1621519-26-3 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Envonalkib is a small molecule drug. The usage of the INN stem '-alkib' in the name indicates that Envonalkib is a ALK (anaplastic lymphoma kinase) inhibitor. Envonalkib has a monoisotopic molecular weight of 505.14 Da. |
Cross-references: BindingDB: 261686 CHEMBL5095063