Molecule Details
| InChIKey | BUGYDGFZZOZRHP-UHFFFAOYSA-N |
|---|---|
| Compound Name | Memantine |
| Canonical SMILES | CC12CC3CC(C)(C1)CC(N)(C3)C2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.39 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01043 |
|---|---|
| Drug Name | Memantine |
| CAS Number | 19982-08-2 |
| Groups | approved investigational |
| ATC Codes | N06DA52 N06DX01 N06DA53 |
| Description | Initially approved by the FDA in 2013, memantine is an N-methyl-D-aspartate (NMDA) receptor antagonist used in the management of Alzheimer's Disease (AD). It is different from many other Alzheimer's Disease medications, as it works by a different mechanism than the cholinesterase enzyme inhibitors n... |
Categories: Anti-Dementia Drugs Anti-Dyskinesia Agents Anti-Parkinson Drugs Bridged-Ring Compounds Central Nervous System Agents Cholinesterase Inhibitors Cytochrome P-450 CYP2A6 Inhibitors Cytochrome P-450 CYP2A6 Inhibitors (weak) Cytochrome P-450 CYP2B6 Inhibitors Cytochrome P-450 CYP2B6 Inhibitors (strong) Cytochrome P-450 CYP2C19 Inhibitors Cytochrome P-450 CYP2C19 Inhibitors (weak) Cytochrome P-450 Enzyme Inhibitors Dopamine Agents Drugs that are Mainly Renally Excreted Excitatory Amino Acid Antagonists Miscellaneous Central Nervous System Agents N-methyl-D-aspartate Receptor Antagonist NMDA Receptor Antagonists Nervous System Neurotransmitter Agents OCT2 Substrates Psychoanaleptics
Cross-references: BindingDB: 50062599 ChEBI: 64312 CHEMBL807 ChemSpider: 3914 Drugs Product Database (DPD): 13366 C13736 D08174 PharmGKB: PA10364 PubChem:4054 PubChem:46506702 RxCUI: 6719 Therapeutic Targets Database: DAP000493 Wikipedia: Memantine
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P22303 | ACHE | Homo sapiens | Human | PF08674 PF00135 | 7.2 | IC50 | ChEMBL |
| O15399 | GRIN2D | Homo sapiens | Human | PF01094 PF00060 PF10613 | 6.3 | Ki | ChEMBL |
| O60391 | GRIN3B | Homo sapiens | Human | PF00060 PF10613 | 6.3 | Ki | ChEMBL |
| Q05586 | GRIN1 | Homo sapiens | Human | PF01094 PF00060 PF10613 | 6.3 | Ki | ChEMBL |
| Q12879 | GRIN2A | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 6.3 | IC50 | ChEMBL |
| Q13224 | GRIN2B | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 6.3 | Ki | ChEMBL |
| Q14957 | GRIN2C | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 6.3 | Ki | ChEMBL |
| Q8TCU5 | GRIN3A | Homo sapiens | Human | PF01094 PF00060 PF10613 | 6.3 | Ki | ChEMBL |
DrugBank Target Actions (14)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P11509 | CYP2A6 | Cytochrome P450 2A6 | inhibitor | enzymes |
| P20813 | CYP2B6 | Cytochrome P450 2B6 | inhibitor | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | inhibitor | enzymes |
| P14416 | DRD2 | D(2) dopamine receptor | agonist | targets |
| P14416 | DRD2 | D(2) dopamine receptor | antagonist | targets |
| P36544 | CHRNA7 | Neuronal acetylcholine receptor subunit alpha-7 | antagonist | targets |
| P46098 | HTR3A | 5-hydroxytryptamine receptor 3A | antagonist | targets |
| Q05586 | GRIN1 | Glutamate (NMDA) receptor | antagonist | targets |
| P14867 | GABRA1 | GABA(A) Receptor | binder | targets |
| Q05586 | GRIN1 | Glutamate receptor ionotropic, NMDA 1 | binder | targets |
| P19634 | SLC9A1 | Sodium/hydrogen exchanger 1 | binder | transporters |
| Q96FL8 | SLC47A1 | Multidrug and toxin extrusion protein 1 | binder | transporters |
| Q9H015 | Q9H015 | Solute carrier family 22 member 4 | binder | transporters |
| O15244 | SLC22A2 | Solute carrier family 22 member 2 | substrate | transporters |