Molecule Details
| InChIKey | BTMKEDDEMKKSEF-QGZVFWFLSA-N |
|---|---|
| Canonical SMILES | C=CC(=O)Nc1cc(Nc2nccc(Nc3cc(Cl)c(F)cc3C(C)(C)O)n2)c(OC)cc1N1CC[C@@H](N(C)C)C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.71 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB18925 |
|---|---|
| Drug Name | Sunvozertinib |
| CAS Number | 2370013-12-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Sunvozertinib is an irreversible and selective epidermal growth factor receptor (EGFR) tyrosine kinase inhibitor.[L53488] EGFR is a transmembrane protein with cytoplasmic kinase activity commonly expressed by non-small cell lung carcinomas (NSCLCs).[A40018] EGFR often have mutations that lead to unf... |
Categories: Acids, Acyclic Acrylates Amides BCRP/ABCG2 Inhibitors Cytochrome P-450 CYP2C8 Inducers Cytochrome P-450 CYP2C8 Inducers (strength unknown) Cytochrome P-450 CYP3A Inducers Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Inducers Cytochrome P-450 CYP3A4 Inducers (strength unknown) Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Enzyme Inducers Cytochrome P-450 Substrates Epidermal growth factor receptor (EGFR) tyrosine kinase inhibitors OATP1B1/SLCO1B1 Inhibitors P-glycoprotein inhibitors Tyrosine Kinase Inhibitors
Cross-references: CHEMBL5314564 ChemSpider: 115009350 RxCUI: 2719226
Target Activities (2)
DrugBank Target Actions (8)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inducer | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | inducer | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P00533 | EGFR | Epidermal growth factor receptor | inhibitor | targets |
| P45844 | P45844 | ATP-binding cassette sub-family G member 1 | inhibitor | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | inhibitor | transporters |
| Q9Y6L6 | SLCO1B1 | Solute carrier organic anion transporter family member 1B1 | inhibitor | transporters |
| P45844 | P45844 | ATP-binding cassette sub-family G member 1 | substrate | transporters |