Molecule Details
| InChIKey | BTGNGJJLZOIYID-UHFFFAOYSA-N |
|---|---|
| Compound Name | Sivelestat |
| Canonical SMILES | CC(C)(C)C(=O)Oc1ccc(S(=O)(=O)Nc2ccccc2C(=O)NCC(=O)O)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.92 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12863 |
|---|---|
| Drug Name | Sivelestat |
| CAS Number | 127373-66-4 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Sivelestat has been used in trials studying the treatment of Acute Lung Injury and Respiratory Distress Syndrome, Adult. |
Categories: Amides Amino Acids Amino Acids, Peptides, and Proteins Enzyme Inhibitors Protease Inhibitors Serine Protease Inhibitors Sulfones Sulfur Compounds
Cross-references: BindingDB: 50084637 ChEBI: 135704 CHEMBL76688 ChemSpider: 96875 PubChem:107706 PubChem:347829021 Wikipedia: Sivelestat ZINC: ZINC000021298097