Molecule Details
| InChIKey | BQDBKDMTIJBJLA-UHFFFAOYSA-N |
|---|---|
| Compound Name | Metopimazine |
| Canonical SMILES | CS(=O)(=O)c1ccc2c(c1)N(CCCN1CCC(C(N)=O)CC1)c1ccccc1S2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.0 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13591 |
|---|---|
| Drug Name | Metopimazine |
| CAS Number | 14008-44-7 |
| Groups | investigational |
| ATC Codes | A04AD05 |
| Description | nan |
Categories: Alimentary Tract and Metabolism Antiemetics Antiemetics and Antinauseants Autonomic Agents Central Nervous System Agents Gastrointestinal Agents Peripheral Nervous System Agents Piperidines
Cross-references: BindingDB: 179867 ChEBI: 135726 CHEMBL398615 ChemSpider: 24584 RxCUI: 29954 Wikipedia: Metopimazine ZINC: ZINC000000537996
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 10.2 | Ki | ChEMBL;BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 9.2 | Ki | ChEMBL;BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 8.8 | Ki | BindingDB |
| P21728 | DRD1 | Homo sapiens | Human | PF00001 | 8.7 | Ki | BindingDB |
| P35367 | HRH1 | Homo sapiens | Human | PF00001 | 8.1 | Ki | ChEMBL;BindingDB |