Molecule Details
| InChIKey | BNVPFDRNGHMRJS-UHFFFAOYSA-N |
|---|---|
| Compound Name | Edicotinib |
| Canonical SMILES | CC1(C)CC=C(c2nc(C3CC(C)(C)OC(C)(C)C3)ccc2NC(=O)c2nc(C#N)c[nH]2)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.47 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12504 |
|---|---|
| Drug Name | Edicotinib |
| CAS Number | 1142363-52-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | JNJ-40346527 has been used in trials studying the treatment of Health and Arthritis, Rheumatoid. |
Cross-references: BindingDB: 98634 CHEMBL3674570 ChemSpider: 34951020 PubChem:25230468 PubChem:347828735 Wikipedia: Colony_stimulating_factor_1_receptor