Molecule Details
| InChIKey | BKJIXTWSNXCKJH-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CN(NC(=O)CC(=O)NN(C)C(=S)c1ccccc1)C(=S)c1ccccc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.71 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB05719 |
|---|---|
| Drug Name | Elesclomol |
| CAS Number | 488832-69-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Elesclomol is a novel, injectable, drug candidate that kills cancer cells by elevating oxidative stress levels beyond a breaking point, triggering programmed cell death. In preclinical models elesclomol showed potent killing of a broad range of cancer cell types at high doses, and an ability to stro... |
Categories: Amides Sulfur Compounds
Cross-references: ChEBI: 79369 CHEMBL1972860 ChemSpider: 265501 D08909 PubChem:300471 PubChem:175427028 Wikipedia: Elesclomol ZINC: ZINC000001716098