Molecule Details
| InChIKey | BJCJYEYYYGBROF-UHFFFAOYSA-N |
|---|---|
| Compound Name | Flumatinib |
| Canonical SMILES | Cc1ncc(NC(=O)c2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1Nc1nccc(-c2cccnc2)n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.05 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11904 |
|---|---|
| Drug Name | Flumatinib |
| CAS Number | 895519-90-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Flumatinib has been used in trials studying the treatment of Myelogenous Leukemia, Chronic. |
Categories: Acids, Carbocyclic Amides Amines Benzene Derivatives Benzoates Enzyme Inhibitors Protein Kinase Inhibitors Pyridines Tyrosine Kinase Inhibitors
Cross-references: CHEMBL3545413 ChemSpider: 25069687 PubChem:46848036 PubChem:347828237 ZINC: ZINC000068244727
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P00519 | ABL1 | Homo sapiens | Human | PF08919 PF07714 PF00017 PF00018 | 7.8 | IC50 | ChEMBL;BindingDB |
| P11274 | BCR | Homo sapiens | Human | PF09036 PF00168 PF19057 PF00620 PF00621 | 7.8 | IC50 | ChEMBL |
| P09619 | PDGFRB | Homo sapiens | Human | PF00047 PF13927 PF25305 PF07714 | 6.5 | IC50 | ChEMBL;BindingDB |
| P10721 | KIT | Homo sapiens | Human | PF00047 PF07714 | 6.2 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P00519 | ABL1 | Tyrosine-protein kinase ABL1 | inhibitor | targets |