Molecule Details
| InChIKey | BHIAIPWSVYSKJS-UHFFFAOYSA-N |
|---|---|
| Compound Name | Arotinolol |
| Canonical SMILES | CC(C)(C)NCC(O)CSc1nc(-c2ccc(C(N)=O)s2)cs1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.5 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB09204 |
|---|---|
| Drug Name | Arotinolol |
| CAS Number | 68377-92-4 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Arotinolol is an alpha- and beta-receptor blocker developed in Japan. It is a thiopropanolamine with a tertiary butyl moiety. It has been studied for its potential to be an antihypertensive therapy.[T87] Artinolol is being developed by Sumitomo Pharmaceutical Co., Ltd. and it is currently under clin... |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic beta-Antagonists Agents causing hyperkalemia Alcohols Amines Amino Alcohols Bradycardia-Causing Agents Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 Substrates Drugs that are Mainly Renally Excreted Hypotensive Agents Neurotransmitter Agents Propanols
Cross-references: BindingDB: 81885 ChEBI: 135569 CHEMBL93298 ChemSpider: 2152 D07465 PubChem:2239 PubChem:310265112 Wikipedia: Arotinolol
Target Activities (2)
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | Alpha-1-acid glycoprotein 1 | substrate | carriers |
| P02768 | ALB | Albumin | substrate | carriers |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P07550 | ADRB2 | Beta-2 adrenergic receptor | antagonist | targets |
| P08588 | ADRB1 | Beta-1 adrenergic receptor | antagonist | targets |
| P35348 | ADRA1A | Alpha-1 adrenergic receptors | antagonist | targets |