Molecule Details
| InChIKey | BGRJTUBHPOOWDU-UHFFFAOYSA-N |
|---|---|
| Compound Name | Sulpiride |
| Canonical SMILES | CCN1CCCC1CNC(=O)c1cc(S(N)(=O)=O)ccc1OC |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 17 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.32 |
| Source | BindingDB;ChEMBL;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00391 |
|---|---|
| Drug Name | Sulpiride |
| CAS Number | 15676-16-1 |
| Groups | approved withdrawn |
| ATC Codes | N05AL01 |
| Description | Sulpiride first appeared in published literature in 1967.[A229538] Clinical studies show a greater effect on treating the negative symptoms of schizophrenia rather than positive symptoms at low doses, though the effects are more equal at higher doses.[A229683] Sulpiride is not approved by the FDA, H... |
Categories: Acids, Carbocyclic Amides Antidepressive Agents Antidepressive Agents, Second-Generation Antipsychotic Agents BCRP/ABCG2 Substrates Benzamides and benzamide derivatives Benzene Derivatives Benzoates Central Nervous System Agents Central Nervous System Depressants Cholinesterase Inhibitors Dopamine Agents Dopamine Antagonists Dopamine D2 Receptor Antagonists MATE 1 Substrates MATE 2 Substrates MATE substrates Moderate Risk QTc-Prolonging Agents Nervous System Neurotoxic agents Neurotransmitter Agents OCT1 substrates OCT2 Substrates P-glycoprotein substrates Psycholeptics Psychotropic Drugs QTc Prolonging Agents Tranquilizing Agents
Cross-references: BindingDB: 11638 ChEBI: 32168 CHEMBL26 ChemSpider: 5162 Guide to Pharmacology: 958 IUPHAR: 958 D01226 PharmGKB: PA164745485 PubChem:5355 PubChem:46504855 RxCUI: 10239 Therapeutic Targets Database: DAP000310 Wikipedia: Sulpiride
Target Activities (17)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P23280 | CA6 | Homo sapiens | Human | PF00194 | 9.1 | Ki | ChEMBL;BindingDB |
| P43166 | CA7 | Homo sapiens | Human | PF00194 | 8.4 | Ki | ChEMBL;BindingDB |
| O43570 | CA12 | Homo sapiens | Human | PF00194 | 8.4 | Ki | ChEMBL;BindingDB |
| Q9Y2D0 | CA5B | Homo sapiens | Human | PF00194 | 7.8 | Ki | ChEMBL |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 7.4 | Ki | ChEMBL;BindingDB |
| P00915 | CA1 | Homo sapiens | Human | PF00194 | 7.4 | IC50 | ChEMBL;BindingDB |
| P00918 | CA2 | Homo sapiens | Human | PF00194 | 7.4 | Ki | ChEMBL;BindingDB |
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 7.4 | pIC50 | TTD_MultiTarget |
| Q16790 | CA9 | Homo sapiens | Human | PF00194 | 7.3 | Ki | ChEMBL;BindingDB |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 7.3 | Ki | BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 7.2 | Ki | ChEMBL;BindingDB |
| P35218 | CA5A | Homo sapiens | Human | PF00194 | 6.8 | Ki | ChEMBL |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |
| Q6FTL6 | NCE103 | Candida glabrata (strain ATCC 2001 / BCRC 20586 / JCM 3761 / NBRC 0622 / NRRL Y-65 / CBS 138) | Pathogen | PF00484 | 7.0 | Ki | ChEMBL |
| O24855 | cynT | Helicobacter pylori (strain ATCC 700392 / 26695) | Pathogen | PF00484 | 6.8 | Ki | ChEMBL;BindingDB |
| P9WPJ9 | mtcA2 | Mycobacterium tuberculosis (strain ATCC 25618 / H37Rv) | Pathogen | PF00484 | 6.6 | Ki | ChEMBL;BindingDB |
| Q3I4V7 | CAN2 | Cryptococcus neoformans | Pathogen | PF00484 | 6.1 | Ki | ChEMBL |
DrugBank Target Actions (14)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | binder | carriers |
| P06276 | BCHE | Cholinesterase | inhibitor | enzymes |
| P14416 | DRD2 | D(2) dopamine receptor | antagonist | targets |
| P21917 | DRD4 | D(4) dopamine receptor | antagonist | targets |
| P35462 | DRD3 | D(3) dopamine receptor | antagonist | targets |
| P00918 | CA2 | Carbonic anhydrase 2 | inhibitor | targets |
| P07451 | CA3 | Carbonic anhydrase 3 | inhibitor | targets |
| O15244 | SLC22A2 | Solute carrier family 22 member 2 | substrate | transporters |
| O15245 | SLC22A1 | Solute carrier family 22 member 1 | substrate | transporters |
| O75751 | SLC22A3 | Solute carrier family 22 member 3 | substrate | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| Q86VL8 | SLC47A2 | Multidrug and toxin extrusion protein 2 | substrate | transporters |
| Q96FL8 | SLC47A1 | Multidrug and toxin extrusion protein 1 | substrate | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | substrate | transporters |