Molecule Details
| InChIKey | BFCRRLMMHNLSCP-UHFFFAOYSA-N |
|---|---|
| Compound Name | Brodimoprim |
| Canonical SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1Br |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.51 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13795 |
|---|---|
| Drug Name | Brodimoprim |
| CAS Number | 56518-41-3 |
| Groups | experimental |
| ATC Codes | J01EA02 |
| Description | nan |
Categories: Anti-Infective Agents Antibacterials for Systemic Use Antiinfectives for Systemic Use Enzyme Inhibitors Folic Acid Antagonists Pyrimidines Sulfonamides and trimethoprim Trimethoprim and Derivatives
Cross-references: BindingDB: 50027970 ChEBI: 131726 CHEMBL31891 ChemSpider: 62004 D07238 RxCUI: 19727 Wikipedia: Brodimoprim ZINC: ZINC000000005824