Molecule Details
| InChIKey | BDABGOLMYNHHTR-UHFFFAOYSA-N |
|---|---|
| Compound Name | Perzinfotel |
| Canonical SMILES | O=c1c2c(c1=O)N(CCP(=O)(O)O)CCCN2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.52 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12365 |
|---|---|
| Drug Name | Perzinfotel |
| CAS Number | 144912-63-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Perzinfotel has been used in trials studying the treatment of Diabetes Mellitus and Diabetic Neuropathy, Painful. |
Categories: Aza Compounds Organophosphorus Compounds
Cross-references: BindingDB: 86494 CHEMBL452461 ChemSpider: 5293443 PubChem:6918236 PubChem:347828617 Wikipedia: Perzinfotel ZINC: ZINC000026496985
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| O15399 | GRIN2D | Homo sapiens | Human | PF01094 PF00060 PF10613 | 7.5 | IC50 | ChEMBL |
| O60391 | GRIN3B | Homo sapiens | Human | PF00060 PF10613 | 7.5 | IC50 | ChEMBL |
| Q05586 | GRIN1 | Homo sapiens | Human | PF01094 PF00060 PF10613 | 7.5 | IC50 | ChEMBL |
| Q12879 | GRIN2A | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 7.5 | IC50 | ChEMBL |
| Q13224 | GRIN2B | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 7.5 | IC50 | ChEMBL |
| Q14957 | GRIN2C | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 7.5 | IC50 | ChEMBL |
| Q8TCU5 | GRIN3A | Homo sapiens | Human | PF01094 PF00060 PF10613 | 7.5 | IC50 | ChEMBL |