Molecule Details
| InChIKey | BBTFKAOFCSOZMB-UHFFFAOYSA-N |
|---|---|
| Compound Name | Lotamilast |
| Canonical SMILES | CNc1nc(-c2cccc(NC(=O)c3ccc(C(=O)OC)cc3)c2)c2cc(OC)c(OC)cc2n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.55 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12776 |
|---|---|
| Drug Name | Lotamilast |
| CAS Number | 947620-48-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | E6005 has been used in trials studying the treatment of Atopic Dermatitis. |
Categories: Acids, Carbocyclic Antipruritics Heterocyclic Compounds, Fused-Ring Phosphodiesterase 4 Inhibitors Phosphodiesterase Inhibitors
Cross-references: CHEMBL3989967 ChemSpider: 32701117 PubChem:24864553 PubChem:347828958 ZINC: ZINC000113676839
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 8.6 | IC50 | ChEMBL |
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 8.6 | IC50 | ChEMBL;BindingDB |
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 8.6 | IC50 | ChEMBL |
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 8.6 | IC50 | ChEMBL |
| Q86V67 | PDE4 | Homo sapiens | Human | PF00233 | 8.6 | IC50 | ChEMBL |