Molecule Details
| InChIKey | AXKPFOAXAHJUAG-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pipamperone |
| Canonical SMILES | NC(=O)C1(N2CCCCC2)CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 14 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.79 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB09286 |
|---|---|
| Drug Name | Pipamperone |
| CAS Number | 1893-33-0 |
| Groups | investigational |
| ATC Codes | N05AD05 |
| Description | Pipamperone is a typical antipsychotic of the _butyrophenone_ family used in the treatment of schizophrenia. It was developed by Janssen Pharmaceutica in 1961 and started its first round of clinical trials in 1963 [L1514, L1518]. In an effort to improve [haloperidol]'s pharmacological effects, Janss... |
Categories: Antidepressive Agents Antipsychotic Agents Butyrophenone Derivatives Central Nervous System Agents Central Nervous System Depressants Dopamine Antagonists Dopamine D2 Receptor Antagonists Hypotensive Agents Ketones Nervous System Neurotoxic agents Neurotransmitter Agents Psycholeptics Psychotropic Drugs Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin Agents Serotonin Receptor Antagonists Tranquilizing Agents
Cross-references: BindingDB: 81483 ChEBI: 78549 CHEMBL440294 ChemSpider: 4664 D02622 PubChem:4830 PubChem:310265179 RxCUI: 33739 Wikipedia: Pipamperone ZINC: ZINC000021297287
Target Activities (14)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 8.3 | Ki | BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 8.2 | Ki | BindingDB |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 7.5 | Ki | BindingDB |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 7.3 | Ki | BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 6.9 | Ki | BindingDB |
| P28222 | HTR1B | Homo sapiens | Human | PF00001 | 6.8 | Ki | BindingDB |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.6 | Ki | BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 6.6 | Ki | BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.5 | Ki | BindingDB |
| P28221 | HTR1D | Homo sapiens | Human | PF00001 | 6.2 | Ki | BindingDB |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.1 | Ki | BindingDB |
| P20366 | TAC1 | Homo sapiens | Human | PF02202 | 6.0 | Ki | BindingDB |
| P21731 | TBXA2R | Homo sapiens | Human | PF00001 | 6.0 | Ki | BindingDB |
| P31645 | SLC6A4 | Homo sapiens | Human | PF03491 PF00209 | 6.0 | Ki | BindingDB |
DrugBank Target Actions (8)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P28223 | HTR2A | 5-hydroxytryptamine receptor 2A | agonist | targets |
| P08913 | ADRA2A | Alpha-2A adrenergic receptor | antagonist | targets |
| P14416 | DRD2 | D(2) dopamine receptor | antagonist | targets |
| P21728 | DRD1 | D(1A) dopamine receptor | antagonist | targets |
| P21917 | DRD4 | D(4) dopamine receptor | antagonist | targets |
| P35348 | ADRA1A | Alpha-1 adrenergic receptors | antagonist | targets |
| P35462 | DRD3 | D(3) dopamine receptor | binder | targets |
| P41595 | HTR2B | 5-hydroxytryptamine receptor 2B | binder | targets |