Molecule Details
| InChIKey | AWSRDDSRQUJMAJ-LCAJTWGOSA-N |
|---|---|
| Canonical SMILES | C[C@H]1C[C@@H](N2C(=N)N[C@](C)(c3cccc(NC(=O)c4cccc(C#N)c4)c3Cl)CC2=O)CCO1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.5 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB17096 |
|---|---|
| Drug Name | UCB7362 |
| CAS Number | nan |
| Groups | experimental |
| ATC Codes | nan |
| Description | UCB7362 is an orally active plasmepsin X (PMX) inhibitor currently investigated for the treatment of malaria.[A254222] Plasmepsins are aspartyl proteases produced by the malaria parasite _Plasmodium falciparum_, and PMX is considered to be essential for parasite egress and invasion.[A254232] UCB7362... |