Molecule Details
| InChIKey | AWGQQZVAXXLVMT-ORYVFAGJSA-N |
|---|---|
| Canonical SMILES | CO[C@@H]1CC[C@@H](CNc2ccc(S(=O)(=O)NC(=O)c3ccc(N4CCN5CC6=C(c7ccc(Cl)cc7)CC(C)(C)C[C@H]6OCCCOC[C@@H]5C4)cc3N3CCCOc4nc5[nH]ccc5cc43)cc2[N+](=O)[O-])OC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.71 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21698 |
|---|---|
| Drug Name | Surzetoclax |
| CAS Number | 2858632-01-4 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Surzetoclax is a small molecule drug. The usage of the INN stem '-toclax' in the name indicates that Surzetoclax is a B-cell lymphoma 2 (Bcl-2) inhibitor. Surzetoclax has a monoisotopic molecular weight of 1038.41 Da. |
Cross-references: BindingDB: 669483 CHEMBL6068032