Molecule Details
| InChIKey | AWDJJMXJUOHGLC-UHFFFAOYSA-N |
|---|---|
| Compound Name | Gsk-356278 |
| Canonical SMILES | CCn1ncc2c(NC3CCOCC3)c(-c3nnc(Cc4sc(C)nc4C)o3)cnc21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.57 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12542 |
|---|---|
| Drug Name | GSK-356278 |
| CAS Number | 720704-34-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Gsk356278 has been used in trials studying the treatment and basic science of Anxiety Disorders, Huntington Disease, Depressive Disorder, Huntingtons Disease, and Depressive Disorder, Major, among others. |
Categories: Oxazoles Sulfur Compounds
Cross-references: ChemSpider: 8428126 PubChem:10252640 PubChem:347828768 ZINC: ZINC000038428932