Molecule Details
| InChIKey | AVSMSXHPIYIKIJ-UHFFFAOYSA-N |
|---|---|
| Compound Name | Dtp-348 |
| Canonical SMILES | Cc1ncc([N+](=O)[O-])n1CCNS(N)(=O)=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.93 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12741 |
|---|---|
| Drug Name | DTP-348 |
| CAS Number | 1383370-92-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Dtp348 has been used in trials studying the treatment of Solid Tumors and Head and Neck Neoplasms. |
Cross-references: CHEMBL3087323 ChemSpider: 31147316 PDB: 2VQ PubChem:57413968 PubChem:347828931
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q16790 | CA9 | Carbonic anhydrase 9 | inhibitor | targets |