Molecule Details
| InChIKey | AVDSOVJPJZVBTC-CTYIDZIISA-N |
|---|---|
| Canonical SMILES | CC1(C)CC(=O)c2c(C(F)(F)F)nn(-c3ccc(C(N)=O)c(N[C@H]4CC[C@H](OC(=O)CN)CC4)c3)c2C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.65 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06070 |
|---|---|
| Drug Name | SNX-5422 |
| CAS Number | 908115-27-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | SNX-5422 is a synthetic, novel, small molecule Hsp90 Inhibitor. As an oral formulation that demonstrates strong efficacy and tolerability, SNX-5422 is positioned as a breakthrough therapy with broad applicability across a wide range of cancers. |
Categories: Acids, Carbocyclic Amides Amino Acids Amino Acids, Peptides, and Proteins Benzene Derivatives Benzoates Heterocyclic Compounds, Fused-Ring Pyrazoles
Cross-references: CHEMBL1195136 ChemSpider: 25060921 PubChem:44195571 PubChem:347827754