Molecule Details
| InChIKey | AUYYCJSJGJYCDS-LBPRGKRZSA-N |
|---|---|
| Compound Name | Liothyronine |
| Canonical SMILES | N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.96 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00279 |
|---|---|
| Drug Name | Liothyronine |
| CAS Number | 6893-02-3 |
| Groups | approved investigational vet_approved |
| ATC Codes | H03AA03 H03AA02 |
| Description | Liothyronine is a thyroidal hormone T3 which is normally produced by the thyroid gland in a ratio 4:1 when compared with T4: T3. Liothyronine is the active form of thyroxine which is composed in a basic chemical structure by a tyrosine with bound iodine.[T457] The exogenous liothyronine product was ... |
Categories: Agents used to treat hypothyroidism Drugs that are Mainly Renally Excreted Hormones Hormones, Hormone Substitutes, and Hormone Antagonists OAT3/SLC22A8 Inhibitors OATP1B1/SLCO1B1 Substrates OATP1B3 substrates P-glycoprotein inducers Systemic Hormonal Preparations, Excl. Sex Hormones and Insulins Thyroid Products Thyronines Thyroxine-binding globulin substrates Triiodothyronine UGT1A1 Substrates l-Triiodothyronine
Cross-references: BindingDB: 18860 ChEBI: 533015 CHEMBL1544 ChemSpider: 5707 Drugs Product Database (DPD): 9954 Guide to Pharmacology: 2634 IUPHAR: 2634 C02465 PDB: T3 PharmGKB: PA164778866 PubChem:5920 PubChem:46506352 RxCUI: 10814 Therapeutic Targets Database: DAP000082 Wikipedia: Liothyronine ZINC: ZINC000003830999
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P10827 | THRA | Homo sapiens | Human | PF00104 PF00105 | 9.6 | Kd | ChEMBL;BindingDB |
| P10828 | THRB | Homo sapiens | Human | PF00104 PF00105 | 9.6 | IC50 | ChEMBL;BindingDB |
| P30542 | ADORA1 | Homo sapiens | Human | PF00001 | 6.5 | IC50 | ChEMBL |
| P37231 | PPARG | Homo sapiens | Human | PF00104 PF12577 PF00105 | 6.2 | Kd | ChEMBL;BindingDB |
DrugBank Target Actions (20)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02766 | TTR | Transthyretin | binder | carriers |
| P02768 | ALB | Albumin | binder | carriers |
| P05543 | P05543 | Thyroxine-binding globulin | substrate | carriers |
| P22309 | UGT1A1 | UDP-glucuronosyltransferase 1A1 | substrate | enzymes |
| P10827 | THRA | Thyroid hormone receptor alpha | agonist | targets |
| P10828 | THRB | Thyroid hormone receptor beta | agonist | targets |
| P12004 | PCNA | DNA sliding clamp PCNA | antagonist | targets |
| Q01650 | Q01650 | Large neutral amino acids transporter small subunit 1 | binder | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inducer | transporters |
| Q8TCC7 | SLC22A8 | Organic anion transporter 3 | inhibitor | transporters |
| Q8TF71 | Q8TF71 | Monocarboxylate transporter 10 | inhibitor | transporters |
| Q96BD0 | Q96BD0 | Solute carrier organic anion transporter family member 4A1 | inhibitor | transporters |
| Q9NYB5 | Q9NYB5 | Solute carrier organic anion transporter family member 1C1 | inhibitor | transporters |
| P46721 | P46721 | Solute carrier organic anion transporter family member 1A2 | substrate | transporters |
| Q14973 | SLC10A1 | Hepatic sodium/bile acid cotransporter | substrate | transporters |
| Q6ZQN7 | SLCO4C1 | Solute carrier organic anion transporter family member 4C1 | substrate | transporters |
| Q96BD0 | Q96BD0 | Solute carrier organic anion transporter family member 4A1 | substrate | transporters |
| Q9NPD5 | SLCO1B3 | Solute carrier organic anion transporter family member 1B3 | substrate | transporters |
| Q9NYB5 | Q9NYB5 | Solute carrier organic anion transporter family member 1C1 | substrate | transporters |
| Q9Y6L6 | SLCO1B1 | Solute carrier organic anion transporter family member 1B1 | substrate | transporters |