Molecule Details
| InChIKey | ARAIBEBZBOPLMB-UFGQHTETSA-N |
|---|---|
| Compound Name | Zanamivir |
| Canonical SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1NC(=N)N |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.0 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00558 |
|---|---|
| Drug Name | Zanamivir |
| CAS Number | 139110-80-8 |
| Groups | approved investigational |
| ATC Codes | J05AH01 |
| Description | A guanido-neuraminic acid that is used to inhibit neuraminidase. |
Categories: Acids, Acyclic Amidines Amino Sugars Anti-Infective Agents Antiinfectives for Systemic Use Antiviral Agents Antivirals for Systemic Use Carbohydrates Direct Acting Antivirals Drugs that are Mainly Renally Excreted Enzyme Inhibitors Guanidines Hydroxy Acids Neuraminic Acids Neuraminidase Inhibitors Pyrans Sialic Acids Sugar Acids
Cross-references: BindingDB: 50330326 ChEBI: 50663 CHEMBL222813 ChemSpider: 54842 Drugs Product Database (DPD): 11911 C08095 D00902 PDB: ZMR PharmGKB: PA164740891 PubChem:60855 PubChem:46508581 RxCUI: 69722 Therapeutic Targets Database: DAP000715 Wikipedia: Zanamivir ZINC: ZINC000003918138