Molecule Details
| InChIKey | AQRLDDAFYYAIJP-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pruvanserin |
| Canonical SMILES | N#Cc1c[nH]c2c(C(=O)N3CCN(CCc4ccc(F)cc4)CC3)cccc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.05 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13094 |
|---|---|
| Drug Name | Pruvanserin |
| CAS Number | 443144-26-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Pruvanserin has been used in trials studying the treatment of Sleep Initiation and Maintenance Disorders. |
Cross-references: BindingDB: 50324540 CHEMBL1215661 ChemSpider: 4938310 PubChem:6433122 PubChem:347829218 Wikipedia: Pruvanserin ZINC: ZINC000056898757
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 9.3 | Ki | ChEMBL;BindingDB |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 6.8 | Ki | ChEMBL |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 6.7 | Ki | ChEMBL |
| P28221 | HTR1D | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P28223 | HTR2A | 5-hydroxytryptamine receptor 2A | modulator | targets |