Molecule Details
| InChIKey | AQHMBDAHQGYLIU-XNFHFXFQSA-N |
|---|---|
| Compound Name | Scy-635 |
| Canonical SMILES | C/C=C/C[C@@H](C)[C@@H](O)[C@H]1C(=O)N[C@@H](CC)C(=O)N(C)[C@H](SCCN(C)C)C(=O)N(C)[C@@H](CC(C)(C)O)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.15 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12451 |
|---|---|
| Drug Name | SCY-635 |
| CAS Number | 210759-10-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | SCY-635 has been investigated for the treatment of Chronic Hepatitis C and Hepatitis C Infection. |
Categories: Amino Acids, Peptides, and Proteins Peptides Peptides, Cyclic
Cross-references: BindingDB: 50136473 CHEMBL1269597 ChemSpider: 4980198 PubChem:6479267 PubChem:347828692
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P30405 | PPIF | Homo sapiens | Human | PF00160 | 8.5 | Kd | ChEMBL |
| P62937 | PPIA | Homo sapiens | Human | PF00160 | 8.5 | IC50 | ChEMBL |
| P23284 | PPIB | Homo sapiens | Human | PF00160 | 8.3 | IC50 | ChEMBL |
| Q72547 | pol | Human immunodeficiency virus type 1 | Pathogen | PF00075 PF00078 PF06815 PF06817 | 7.3 | IC50 | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P49069 | P49069 | Guided entry of tail-anchored proteins factor CAMLG | modulator | targets |