Molecule Details
| InChIKey | AQHHHDLHHXJYJD-UHFFFAOYSA-N |
|---|---|
| Compound Name | Propranolol |
| Canonical SMILES | CC(C)NCC(O)COc1cccc2ccccc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 11 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.06 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00571 |
|---|---|
| Drug Name | Propranolol |
| CAS Number | 525-66-6 |
| Groups | approved investigational |
| ATC Codes | C07FX01 C07AA05 C07BA05 |
| Description | Propranolol is a racemic mixture of 2 enantiomers where the S(-)-enantiomer has approximately 100 times the binding affinity for beta adrenergic receptors.[L6904] Propranolol is used to treat a number of conditions but most commonly is used for hypertension.[L6901,L6904,L6907] Propranolol was grante... |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic beta-Antagonists Agents causing hyperkalemia Alcohols Amines Amino Alcohols Antiarrhythmic agents Antihypertensive Agents Antihypertensive Agents Indicated for Hypertension Beta Blocking Agents and Thiazides Beta Blocking Agents, Non-Selective Beta Blocking Agents, Non-Selective, and Thiazides Bradycardia-Causing Agents Cardiovascular Agents Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 CYP2C19 Substrates Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (weak) Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 CYP3A7 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs that are Mainly Renally Excreted Hypotensive Agents Monoamine Oxidase A Inhibitors for interaction with Monoamine Oxidase A substrates Naphthalenes Negative Inotrope Neurotransmitter Agents OCT2 Inhibitors P-glycoprotein inhibitors P-glycoprotein substrates Phenoxypropanolamines Propanolamines Propanols QTc Prolonging Agents Vasodilating Agents
Cross-references: BindingDB: 25761 ChEBI: 8499 CHEMBL27 ChemSpider: 4777 Drugs Product Database (DPD): 10127 Guide to Pharmacology: 564 IUPHAR: 564 C07407 D08443 PharmGKB: PA451145 PubChem:4946 PubChem:46505387 RxCUI: 8787 Therapeutic Targets Database: DAP000089 Wikipedia: Propranolol
Target Activities (11)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P07550 | ADRB2 | Homo sapiens | Human | PF00001 | 8.9 | Kd | ChEMBL |
| P08588 | ADRB1 | Homo sapiens | Human | PF00001 | 8.6 | Kd | ChEMBL |
| P13945 | ADRB3 | Homo sapiens | Human | PF00001 | 8.4 | Kd | ChEMBL |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 7.0 | Ki | ChEMBL |
| P31645 | SLC6A4 | Homo sapiens | Human | PF03491 PF00209 | 6.6 | IC50 | ChEMBL |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 6.6 | IC50 | ChEMBL |
| Q5BJF2 | TMEM97 | Homo sapiens | Human | PF05241 | 6.5 | Ki | ChEMBL |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 6.4 | Ki | ChEMBL |
| Q9Y466 | NR2E1 | Homo sapiens | Human | PF00104 PF00105 | 6.3 | Kd | ChEMBL |
| P50406 | HTR6 | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL |
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
DrugBank Target Actions (18)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | Alpha-1-acid glycoprotein 1 | binder | carriers |
| P02768 | ALB | Albumin | binder | carriers |
| P04798 | CYP1A1 | Cytochrome P450 1A1 | inhibitor | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | inhibitor | enzymes |
| P21397 | MAOA | Amine oxidase [flavin-containing] A | inhibitor | enzymes |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | substrate | enzymes |
| P24462 | CYP3A7 | Cytochrome P450 3A7 | substrate | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | substrate | enzymes |
| P07550 | ADRB2 | Beta-2 adrenergic receptor | antagonist | targets |
| P08588 | ADRB1 | Beta-1 adrenergic receptor | antagonist | targets |
| P13945 | ADRB3 | Beta-3 adrenergic receptor | antagonist | targets |
| P08908 | HTR1A | 5-hydroxytryptamine receptor 1A | other/unknown | targets |
| P28222 | HTR1B | 5-hydroxytryptamine receptor 1B | other/unknown | targets |
| O15244 | SLC22A2 | Solute carrier family 22 member 2 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |