Molecule Details
| InChIKey | AMKVXSZCKVJAGH-UHFFFAOYSA-N |
|---|---|
| Compound Name | Naratriptan |
| Canonical SMILES | CNS(=O)(=O)CCc1ccc2[nH]cc(C3CCN(C)CC3)c2c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.19 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00952 |
|---|---|
| Drug Name | Naratriptan |
| CAS Number | 121679-13-8 |
| Groups | approved |
| ATC Codes | N02CC02 |
| Description | Naratriptan is a triptan drug that is selective for the 5-hydroxytryptamine1 receptor subtype. It is typically used for the treatment of migraine headaches. |
Categories: Agents that produce hypertension Amines Analgesics Antidepressive Agents Antimigraine Preparations Biogenic Amines Biogenic Monoamines Cardiovascular Agents Central Nervous System Depressants Heterocyclic Compounds, Fused-Ring Indoles Monoamine Oxidase A Substrates Nervous System Neurotransmitter Agents Selective Serotonin 5-HT1 Receptor Agonists Selective Serotonin Agonists Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin 1b Receptor Agonists Serotonin 1d Receptor Agonists Serotonin 5-HT1 Receptor Agonists Serotonin Agents Serotonin Modulators Serotonin Receptor Agonists Serotonin-1b and Serotonin-1d Receptor Agonist Triptans Vasoconstrictor Agents
Cross-references: BindingDB: 50073682 ChEBI: 7478 CHEMBL1278 ChemSpider: 4287 Drugs Product Database (DPD): 11770 Guide to Pharmacology: 45 IUPHAR: 45 C07792 D08255 PharmGKB: PA450597 PubChem:4440 PubChem:46507243 RxCUI: 141366 Therapeutic Targets Database: DAP000890 Wikipedia: Naratriptan ZINC: ZINC000000004076
Target Activities (3)
DrugBank Target Actions (5)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P21397 | MAOA | Amine oxidase [flavin-containing] A | substrate | enzymes |
| P08908 | HTR1A | 5-hydroxytryptamine receptor 1A | agonist | targets |
| P28221 | HTR1D | 5-hydroxytryptamine receptor 1D | agonist | targets |
| P28222 | HTR1B | 5-hydroxytryptamine receptor 1B | agonist | targets |
| P30939 | HTR1F | 5-hydroxytryptamine receptor 1F | agonist | targets |