Molecule Details
| InChIKey | ALBKMJDFBZVHAK-UHFFFAOYSA-N |
|---|---|
| Compound Name | Ethyl 4-(methoxymethyl)-6-(phenylmethoxy)-9H-pyrido(3,4-b)indole-3-carboxylate |
| Canonical SMILES | CCOC(=O)c1ncc2[nH]c3ccc(OCc4ccccc4)cc3c2c1COC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 16 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.94 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB17063 |
|---|---|
| Drug Name | ZK-93423 |
| CAS Number | 83910-44-5 |
| Groups | experimental |
| ATC Codes | nan |
| Description | ZK-93423 is a beta-carboline with muscle relaxant activity with agonistic properties at the benzodiazepine receptor.[A253172] |
Categories: Anti-Anxiety Agents Anticonvulsants Central Nervous System Agents Central Nervous System Depressants Heterocyclic Compounds, Fused-Ring Indole Alkaloids Indoles Psychotropic Drugs Pyridines Tranquilizing Agents
Cross-references: BindingDB: 85039 ChEBI: 92593 CHEMBL1518572 ChemSpider: 108771 Wikipedia: ZK-93423 ZINC: ZINC000005857871
Target Activities (16)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| O00591 | GABRP | Homo sapiens | Human | PF02931 PF02932 | 9.3 | IC50 | ChEMBL |
| O14764 | GABRD | Homo sapiens | Human | PF02931 PF02932 | 9.3 | IC50 | ChEMBL |
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 9.3 | IC50 | ChEMBL |
| P47870 | GABRB2 | Homo sapiens | Human | PF02931 PF02932 | 9.3 | IC50 | ChEMBL |
| P48169 | GABRA4 | Homo sapiens | Human | PF02931 PF02932 | 9.3 | IC50 | ChEMBL |
| P78334 | GABRE | Homo sapiens | Human | PF02931 PF02932 | 9.3 | IC50 | ChEMBL |
| Q16445 | GABRA6 | Homo sapiens | Human | PF02931 PF02932 | 9.3 | IC50 | ChEMBL |
| Q8N1C3 | GABRG1 | Homo sapiens | Human | PF02931 PF02932 | 9.3 | IC50 | ChEMBL |
| Q99928 | GABRG3 | Homo sapiens | Human | PF02931 PF02932 | 9.3 | IC50 | ChEMBL |
| Q9UN88 | GABRQ | Homo sapiens | Human | PF02931 PF02932 | 9.3 | IC50 | ChEMBL |
| P14867 | GABRA1 | Homo sapiens | Human | PF02931 PF02932 | 8.4 | Ki | ChEMBL |
| P47869 | GABRA2 | Homo sapiens | Human | PF02931 PF02932 | 8.4 | Ki | ChEMBL |
| P18507 | GABRG2 | Homo sapiens | Human | PF02931 PF02932 | 8.4 | Ki | ChEMBL |
| P28472 | GABRB3 | Homo sapiens | Human | PF02931 PF02932 | 8.4 | Ki | ChEMBL |
| P31644 | GABRA5 | Homo sapiens | Human | PF02931 PF02932 | 8.3 | Ki | ChEMBL |
| P34903 | GABRA3 | Homo sapiens | Human | PF02931 PF02932 | 8.2 | Ki | ChEMBL |