Molecule Details
| InChIKey | AFZSMODLJJCVPP-UHFFFAOYSA-N |
|---|---|
| Compound Name | Accelerator DM |
| Canonical SMILES | c1ccc2sc(SSc3nc4ccccc4s3)nc2c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 12 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.47 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14201 |
|---|---|
| Drug Name | 2,2'-Dibenzothiazyl disulfide |
| CAS Number | 120-78-5 |
| Groups | approved |
| ATC Codes | nan |
| Description | 2,2'-Dibenzothiazyl disulfide is an accelerator used in the processing process for natural and synthetic rubber and plastic regeneration. It is also a known allergen and dermatological sensitizer. Sensitivity to 2,2'-Dibenzothiazyl disulfide may be identified with a clinical patch test. |
Categories: Cell-mediated Immunity Heterocyclic Compounds, Fused-Ring Increased Histamine Release Latex Hypersensitivity Standardized Chemical Allergen Sulfur Compounds Thiazoles
Cross-references: BindingDB: 50444458 ChEBI: 53239 CHEMBL508112 ChemSpider: 8139 RxCUI: 1306112 ZINC: ZINC000001555224
Target Activities (12)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 7.0 | IC50 | ChEMBL |
| Q01959 | SLC6A3 | Homo sapiens | Human | PF00209 | 6.7 | IC50 | ChEMBL |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.6 | Ki | ChEMBL |
| P0DMS8 | ADORA3 | Homo sapiens | Human | PF00001 | 6.6 | IC50 | ChEMBL |
| P09467 | FBP1 | Homo sapiens | Human | PF00316 PF18913 | 6.5 | IC50 | ChEMBL;BindingDB |
| Q15118 | PDK1 | Homo sapiens | Human | PF10436 PF02518 | 6.4 | IC50 | ChEMBL;BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 6.3 | IC50 | ChEMBL |
| P41145 | OPRK1 | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.3 | IC50 | ChEMBL |
| P21728 | DRD1 | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| P41597 | CCR2 | Homo sapiens | Human | PF00001 | 6.0 | Ki | ChEMBL |
| P0DTD1 | rep | Severe acute respiratory syndrome coronavirus 2 | Pathogen | PF13087 PF16251 PF11501 PF12379 PF12124 PF11633 PF06471 PF06460 PF09401 PF20631 PF20633 PF20632 PF19215 PF19216 PF19219 PF19211 PF19218 PF16348 PF19217 PF19213 PF08716 PF08717 PF08710 PF08715 PF06478 PF01661 PF05409 PF00680 | 6.8 | IC50 | ChEMBL |