Molecule Details
| InChIKey | AFNXATANNDIXLG-UHFFFAOYSA-N |
|---|---|
| Compound Name | Sulconazole |
| Canonical SMILES | Clc1ccc(CSC(Cn2ccnc2)c2ccc(Cl)cc2Cl)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 11 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.57 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06820 |
|---|---|
| Drug Name | Sulconazole |
| CAS Number | 61318-90-9 |
| Groups | approved |
| ATC Codes | D01AC09 |
| Description | Sulconazole, brand name Exelderm, is a broad-spectrum anti-fungal agent available as a topical cream and solution. Sulconazole nitrate, the active ingredient, is an imidazole derivative that inhibits the growth of common pathogenic dermatophytes, making it an effective treatment for tinea cruris and... |
Categories: Anti-Infective Agents Antifungal Agents Antifungals for Dermatological Use Antifungals for Topical Use Azole Antifungals Cytochrome P-450 CYP1A2 Inhibitors Cytochrome P-450 CYP1A2 Inhibitors (strength unknown) Cytochrome P-450 CYP2C9 Inhibitors Cytochrome P-450 CYP2C9 Inhibitors (strength unknown) Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (moderate) Cytochrome P-450 Enzyme Inhibitors Dermatologicals Imidazole and Triazole Derivatives
Cross-references: BindingDB: 31770 ChEBI: 77776 CHEMBL1221 ChemSpider: 5127 C08076 D08535 PubChem:5318 PubChem:310264896 RxCUI: 37319 Wikipedia: Sulconazole
Target Activities (11)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P33261 | CYP2C19 | Homo sapiens | Human | PF00067 | 7.8 | IC50 | ChEMBL |
| P08684 | CYP3A4 | Homo sapiens | Human | PF00067 | 7.2 | IC50 | ChEMBL |
| P31645 | SLC6A4 | Homo sapiens | Human | PF03491 PF00209 | 7.0 | IC50 | ChEMBL |
| P24557 | TBXAS1 | Homo sapiens | Human | PF00067 | 6.7 | IC50 | ChEMBL |
| P11712 | CYP2C9 | Homo sapiens | Human | PF00067 | 6.7 | IC50 | ChEMBL |
| P08173 | CHRM4 | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL |
| P05177 | CYP1A2 | Homo sapiens | Human | PF00067 | 6.2 | IC50 | ChEMBL |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |
| P20309 | CHRM3 | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |
| P10635 | CYP2D6 | Homo sapiens | Human | PF00067 | 6.1 | IC50 | ChEMBL |
| P11229 | CHRM1 | Homo sapiens | Human | PF00001 | 6.0 | Ki | ChEMBL |