Molecule Details
| InChIKey | AFGYODUJVVOZAX-CYFREDJKSA-N |
|---|---|
| Canonical SMILES | C=CC(=O)N1CCN([C@@H](CC2CC2)c2ccc([C@H](C)Nc3ncc4c(n3)N(CC)C(=O)OC4)cc2)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.81 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21642 |
|---|---|
| Drug Name | Crelosidenib |
| CAS Number | 2230263-60-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Crelosidenib is a small molecule drug. Crelosidenib is under investigation in clinical trial NCT04603001 (Study of Oral LY3410738 in Patients With Advanced Hematologic Malignancies With IDH1 or IDH2 Mutations). Crelosidenib has a monoisotopic molecular weight of 504.28 Da. |
Cross-references: BindingDB: 497335 CHEMBL6000618