Molecule Details
| InChIKey | AEZZJXJIJFSUEM-QFIPXVFZSA-N |
|---|---|
| Canonical SMILES | Cc1ccc(-n2nccn2)c(C(=O)N2CCCO[C@H]2Cn2ccc(-c3ccc(F)cn3)n2)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.94 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21483 |
|---|---|
| Drug Name | Vornorexant |
| CAS Number | 2265899-49-6 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Vornorexant is a small molecule drug. The usage of the INN stem '-orexant' in the name indicates that Vornorexant is a orexin receptor antagonist. Vornorexant has a monoisotopic molecular weight of 447.18 Da. |
Cross-references: BindingDB: 50543827 CHEMBL4638046