Molecule Details
| InChIKey | ABNXKGFLZFSILK-MOPGFXCFSA-N |
|---|---|
| Canonical SMILES | O=C(O)C[C@H](NC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1)c1cccnc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 9.82 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21212 |
|---|---|
| Drug Name | Elarofiban anhydrous |
| CAS Number | 198958-88-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Elarofiban anhydrous is a small molecule drug. The usage of the INN stem '-fiban' in the name indicates that Elarofiban anhydrous is a fibrinogen receptor antagonist (glycoprotein IIb/IIIa receptor antagonist). Elarofiban anhydrous has a monoisotopic molecular weight of 416.24 Da. |
Categories: Piperidines
Cross-references: BindingDB: 50104600 CHEMBL87728